Добавил:
Sekretar
kiopkiopkiop18@yandex.ru
t.me/Prokururor I Вовсе не секретарь, но почту проверяю
Опубликованный материал нарушает ваши авторские права? Сообщите нам.
Вуз:
Предмет:
Файл:Ординатура / Хирургия / Библиотека им академика М.И. Перельмана / Книга_5733_Библиотеки_им_академика_М_И_Перельмана
.pdf
207
researchers can confirm the presence of specific functional groups and assess the
compound's structural integrity.
X-ray Crystallography: X-ray crystallography is a technique used to determine the
three-dimensional structure of crystalline materials, including organic compounds.
By analyzing the diffraction pattern of X-rays passing through a crystal of the
moramide intermediate, researchers can precisely determine its molecular
structure, including bond lengths, bond angles, and overall conformation.
Thermal Analysis: Thermal analysis techniques such as differential scanning
calorimetric (DSC) and thermo gravimetric analysis (TGA) can be used to
investigate the thermal properties and stability of moramide intermediates. These
techniques help assess the compound's melting point, decomposition temperature,
and any potential thermal degradation pathways.
Nuclear Magnetic Resonance Imaging (MRI): MRI techniques can provide valuable
insights into the pharmacokinetics and distribution of moramide intermediates
within biological systems. By labelling the compound with a suitable contrast
agent, researchers can track its uptake, distribution, and elimination in vivo, aiding
in drug development and pharmacological studies.
https://t.me/med1917
208
MORPHERIDINE
Scientific Name:
(4R,4aS,7aR,12bS)-3-ethenyl-4,4a,7,7a,12b-pentahydro-4,6morpholinomorphinan.
IUPAC Name: ethyl 1-(2-morpholin-4-ylethyl)-4-phenylpiperidine-4- carboxylate
Compound CID: 61121
Molecular Formula: C20H30N2O3
MW: 346.5g/mol
Isomeric SMILES: CCOC(=O)C1(CCN(CC1)CCN2CCOCC2)C3=CC=CC=C3
Molecular Structure:
Physical Properties:
Appearance: Morphine is typically found as a white, crystalline powder or
as small, white crystals.
Odour: It generally has no distinct odour.
Melting Point: The melting point of morphine can vary, but it typically
ranges from around 254 to 255 degrees Celsius (489 to 491 degrees
Fahrenheit).
Boiling Point: Morphine decomposes before it reaches its boiling point.
Solubility: Morphine is sparingly soluble in water, but it is more soluble in
acidic solutions. It is also soluble in alcohol and chloroform. Chemical
properties:-
Route of Administration: Morpheridine is a synthetic opioid analgesic. It is
typically administered through intravenous (IV) injection. This route allows for
rapid onset of action, making it effective for pain relief in medical settings.
https://t.me/med1917
209
However, it's important to note that the administration of Morpheridine should
only be done by trained medical professionals in controlled environments due to
its potency and potential for abuse
Pharmalogical actions: If "Morpheridine" is indeed a new drug, its
pharmacological actions would depend on its chemical structure and intended
therapeutic use. Typically, drugs ending in "-idine" may suggest they belong to the
class of opioid analgesics, but without specific information, it's hard to ascertain its
exact pharmacological action.
If you have access to up-to-date medical literature or drug databases, I'd
recommend consulting those sources for the most accurate and detailed
information on Morpheridine pharmacological actions. Additionally, if it's a new
drug, information may be available through the manufacturer or regulatory
agencies like the FDA (in the United States) or the EMA (in Europe).
Analysis:
Chromatography: Gas Chromatography (GC) or High-Performance Liquid
Chromatography (HPLC) could be used to separate the components of a
sample containing Morpheridine. These techniques are effective for
identifying and quantifying compounds in a mixture based on their
interactions with the chromatographic stationary phase.
Mass Spectrometry (MS): Coupling chromatography with MS, such as GC-
MS or LC-MS, provides additional information about the molecular weight
and structural characteristics of Morpheridine. MS is particularly useful
for detecting and characterizing unknown compounds in a sample.
Infrared Spectroscopy (IR): IR spectroscopy could be employed to analyse
the functional groups present in Morpheridine molecules. This technique
can provide information about the chemical bonds and molecular
structure of the compound.
Nuclear Magnetic Resonance (NMR) Spectroscopy: NMR spectroscopy is
valuable for elucidating the molecular structure of organic compounds. It
can provide detailed information about the connectivity of atoms within
Morpheridine molecules, aiding in its identification and characterization.
UV-Vis Spectroscopy: This technique could be used to analyse the
electronic structure of Morpheridine molecules and determine their
absorbance properties in the ultraviolet and visible regions of the
electromagnetic spectrum.
https://t.me/med1917
210
MORPHINE
Scientific Name:
(4R,4aR,7S,7aR,12bS)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-
methanobenzofuro[3,2-e]isoquinoline-7,9-diol
Molecular structure:
Physical Properties: Morphine is a naturally occurring opioid analgesic derived
from the opium poppy plant. Here are some of its physical properties:
Appearance: Morphine typically appears as white, crystalline powder or
colorless crystals. It can also be found as a brown powder or black tar-like
substance when impurities are present.
Solubility: Morphine is sparingly soluble in water but more soluble in
organic solvents like ethanol and chloroform.
Melting Point: The melting point of morphine varies depending on its form
and purity, but it typically ranges between 254-258°C.
Odor: Morphine itself is odorless, but impurities or degradation products
may produce a slight odor.
Density: The density of morphine varies with its form and purity but
generally falls within the range of 1.21-1.24 g/cm³.
Stability: Morphine is relatively stable under normal conditions but can
degrade upon exposure to light, heat, and air. It should be stored in a cool,
dry place away from light and moisture.
Boiling Point:-The boiling point of morphine is approximately 297-300°C
(567-572°F) under standard atmospheric pressure. However, this value
can vary slightly depending on factors such as purity and the presence of
any impurities.
https://t.me/med1917
211
Molar Mass:-The molar mass of morphine is approximately 285.34 grams
per mole (g/mol).
Chemical Properties:
Chemical Formula: C₁₇H₁₉NO
Chemical Classification: -Morphine belongs to the chemical class of
alkaloids. Alkaloids are a large group of naturally occurring organic
compounds that mostly contain basic nitrogen atoms. Morphine is
specifically classified as an opioid alkaloid due to its analgesic and narcotic
effects on the central nervous system. Opioid alkaloids are derived from
the opium poppy plant (Papaver somniferum) and exert their
pharmacological effects primarily by binding to opioid receptors in the
brain and spinal cord.
Functional Group:-Phenolic Hydroxyl Group (-OH): Morphine contains
multiple hydroxyl (-OH) groups attached to the phenanthrene ring
structure. These hydroxyl groups are responsible for some of morphine's
pharmacological properties, including its analgesic effects.
Tertiary Amine Group (-N(CH3)2): Morphine also contains a tertiary
amine group, which consists of a nitrogen atom bonded to three alkyl
groups (methyl groups, -CH3). This amine group plays a role in the
molecule's pharmacokinetics and contributes to its alkaloid nature.
Ph :The pH of morphine itself is not a well-defined property because it is a
neutral compound. However, when morphine is dissolved in water or
other solvents, it can form salts with acidic or basic properties depending
on the pH of the solution. For example, morphine hydrochloride
(morphine salt) is acidic, with a lower pH, while morphine sulfate
(another common salt) is slightly acidic. The pH of a solution containing
morphine will depend on factors such as the concentration of the
morphine salt and the presence of other substances in the solution.
Route of administration: Morphine can be administered through various routes,
including:
Oral: Morphine can be taken orally in the form of tablets, capsules, or
solutions. However, its oral bioavailability is relatively low due to
extensive first-pass metabolism in the liver.
Intravenous (IV): Morphine can be administered directly into the
bloodstream via injection. This route allows for rapid onset of action and
is commonly used in acute pain management or during surgical
procedures.
https://t.me/med1917
212
Intramuscular (IM): Morphine can also be administered into the muscle
tissue via injection. This route provides slower absorption compared to IV
administration but is still relatively fast-acting.
Subcutaneous (SC): Morphine can be administered subcutaneously, where
it is injected beneath the skin into the fatty tissue. This route provides a
slower onset of action compared to IV or IM administration.
Transdermal: Morphine can be administered through transdermal
patches, which deliver the drug through the skin and into the bloodstream
over an extended period. This route is often used for chronic pain
management.
Rectal: Morphine suppositories can be administered rectally for patients
who cannot take medication orally or intravenously. This route is
sometimes used for palliative care or in patients with severe nausea or
vomiting.
The choice of administration route depends on factors such as the
patient's condition, the severity of pain, the desired onset and duration of action,
and the healthcare provider's preferences.
Pharmacological action of morphine: The pharmacological actions of morphine
primarily involve its interactions with opioid receptors in the central nervous
system. Here are the key pharmacological actions of morphine:
Analgesia: Morphine is a potent analgesic, meaning it relieves pain by
acting on opioid receptors in the brain and spinal cord. It primarily acts on
μ-opioid receptors, reducing the perception of pain and altering the
emotional response to pain.
Sedation: Morphine can cause sedation or drowsiness by acting on certain
regions of the brain involved in sleep-wake cycles and arousal.
Euphoria: Morphine can produce a sense of euphoria or well-being,
particularly when administered in higher doses. This effect is mediated by
its action on opioid receptors in reward pathways of the brain.
Respiratory depression: One of the most significant side effects of
morphine is respiratory depression, where breathing rate and depth are
reduced. This effect occurs due to morphine's actions on brainstem
respiratory centers.
Cough suppression: Morphine has antitussive properties, meaning it
suppresses cough reflexes by acting on cough centers in the brain.
Gastrointestinal effects: Morphine can cause constipation by reducing
gastrointestinal motility and increasing sphincter tone. It can also lead to
https://t.me/med1917
213
nausea and vomiting, although tolerance to these effects may develop over
time.
Pupillary constriction: Morphine causes pupillary constriction (miosis) by
stimulating the parasympathetic nervous system.
Histamine release: Morphine can induce the release of histamine, leading
to vasodilation, hypotension, and potential allergic reactions such as
itching and flushing.
These pharmacological actions collectively contribute to morphine's therapeutic
effects as an analgesic, as well as its potential for abuse and dependence.
Morphine can be analyzed using various physical methods. Here are a few
commonly employed techniques:
1. Melting Point Determination: Morphine has a known melting point range
(approximately 254-258°C). Melting point determination can help identify
the purity of morphine samples and detect the presence of impurities.
2. Boiling Point Determination: Although morphine decomposes before
reaching its boiling point, the determination of its decomposition
temperature can provide useful information about its stability under certain
conditions.
3. Spectroscopic Methods: Techniques such as UV-Visible spectroscopy,
infrared (IR) spectroscopy, and nuclear magnetic resonance (NMR)
spectroscopy can be used to analyze the chemical structure of morphine and
identify functional groups present in the molecule.
4. Mass Spectrometry: Mass spectrometry can provide information about the
molecular weight and fragmentation pattern of morphine, aiding in its
identification and characterization.
5. X-Ray Crystallography: X-ray crystallography can be used to determine the
three-dimensional structure of morphine crystals, providing insights into its
molecular arrangement and crystal packing.
6. Thermal Analysis: Techniques such as differential scanning calorimetry
(DSC) and thermogravimetric analysis (TGA) can be used to study the
thermal behavior of morphine, including its melting behavior,
decomposition temperature, and stability under different temperature
conditions
7. Chromatographic Methods: High-performance liquid chromatography
(HPLC) and gas chromatography (GC) are commonly used to separate and
quantify morphine in complex mixtures, such as pharmaceutical
formulations or biological samples.
https://t.me/med1917
214
Analysis of morphine by chemical methods involves techniques that exploit
its chemical properties or reactions. Here are some common chemical
methods used for the analysis of morphine:
1. Colorimetric Assays: Various colorimetric assays can be employed to detect
and quantify morphine based on specific chemical reactions. For example,
the colorimetric reaction between morphine and reagents like acetic
anhydride and sulfuric acid can be used for its detection
2. Precipitation Reactions: Morphine can form precipitates with specific
reagents, which can be used for qualitative and quantitative analysis. For
instance, morphine reacts with iodine solution to form a yellow precipitate
of iodomorphine.
3. Complexometric Titration: Complexometric titration involves the use of
chelating agents to form stable complexes with metal ions. Morphine can be
titrated with metal ions such as zinc or cadmium ions in the presence of an
appropriate indicator to determine its concentration.
4. Acid-Base Reactions: Morphine contains basic nitrogen atoms that can
undergo acid-base reactions. Titration methods can be employed to
determine the concentration of morphine using acid-base indicators or pH
meters.
5. Hydrolysis Reactions: Morphine can undergo hydrolysis under acidic or
alkaline conditions. Hydrolysis reactions can be utilized for the
quantification of morphine or for its conversion to other derivatives for
analysis.
6. Derivatization Reactions: Chemical derivatization reactions can be
performed to modify morphine's chemical structure, making it amenable to
specific analytical techniques such as gas chromatography or high-
performance liquid chromatography.
7. Redox Reactions: Morphine can participate in redox reactions, which can be
exploited for its analysis. For example, morphine can be oxidized to
morphinone using oxidizing agents like potassium permanganate, and the
reaction can be monitored spectrophotometrically.
https://t.me/med1917
215
MPPP
Scientific Name: The scientific name of the MPPP drug is 1-methyl-4-phenyl-4-
propionoxypiperidine.
Molecular Structure:
Physical Properties: MPPP (1-methyl-4-phenyl-4-propionoxypiperidine) is a
synthetic opioid drug with effects similar to those of morphine and heroin. Its
physical properties include:
Appearance: MPPP typically appears as a white to off-white crystalline
powder or as a white or light yellow solid.
Solubility: It is sparingly soluble in water but more soluble in organic
solvents like ethanol or methanol.
Melting Point: The melting point of MPPP is reported to be around 128-
130°C.
Boiling Point:200-300°C
Odor: It may have a faint chemical odor.
Density: The density of MPPP can vary depending on its form, but it is
typically denser than water.
Chemical properties: The chemical properties of MPPP (1-methyl-4-phenyl-4-
propionoxypiperidine) include:
Chemical Structure: MPPP is a synthetic opioid compound with a
piperidine ring substituted with a methyl group, a phenyl group, and a
propionoxy group. Its chemical formula is C14H19NO2.
Pharmacological Activity: MPPP acts as a potent mu-opioid receptor
agonist, similar to morphine and heroin, leading to analgesic and euphoric
effects when consumed.
https://t.me/med1917
216
Metabolism: In the body, MPPP is metabolized through processes such as
N-demethylation to normeperidine, hydroxylation, and conjugation with
glucuronic acid. Normeperidine, a metabolite of MPPP, can exhibit
neurotoxic effects.
Physical State: MPPP is typically found in the form of a white to off-white
crystalline powder or solid substance.
Solubility: It is sparingly soluble in water but more soluble in organic
solvents like ethanol or methanol.
Stability: MPPP may degrade upon exposure to heat, light, or acidic/basic
conditions.
These chemical properties contribute to MPPP's pharmacological effects,
metabolism, and overall behavior within the body.
Chemical Formula: - The chemical formula for MPPP (1-methyl-4-phenyl-
4-propionoxypiperidine) is C15H21NO2.
Functional Group: -The functional groups present in MPPP include a
piperidine ring, a phenyl group, and an ester functional group.
Ph: The pH of MPPP (1-methyl-4-phenyl-4-propionoxypiperidine) itself isn't
readily available as it's typically encountered in a synthesized form and used as a
controlled substance. However, like many organic compounds, its pH would
depend on its concentration in a solution and any specific additives or solvents
present. Generally, MPPP would not significantly alter the pH of a solution unless
it's part of a formulated medication or mixture with other substances.
Route of administration: MPPP can be administered orally, intravenously, or
through other routes typically associated with opioid drugs, although its use is
illegal due to its high potential for abuse and severe health risks.
Pharmacological Action: MPPP, as an opioid, acts primarily by binding to and
activating opioid receptors in the central nervous system. This action leads to a
variety of effects including pain relief, sedation, and euqphoria. However, MPPP is
associated with significant risks including addiction, respiratory, depression and
overdose.
Physical Analysis: As a controlled substance with no recognized medical use,
detailed physical analysis of MPPP is not widely available. However, its chemical
structure can be analyzed through spectroscopic techniques such as NMR (Nuclear
Magnetic Resonance) spectroscopy and mass spectrometry. Additionally, its
physical properties such as melting point, solubility, and crystalline structure
could be investigated through laboratory methods.
Chemical Method: The chemical analysis of MPPP typically involves techniques
such as chromatography (e.g., gas chromatography or liquid chromatography)
https://t.me/med1917
Соседние файлы в папке Библиотека им академика М.И. Перельмана